C19H24ClNO6 — CID 162630978
(5-chloro-2,3,4-trimethoxyphenyl)-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]methanone (PubChem CID 162630978) has the molecular formula C19H24ClNO6 and a molecular weight of 397.86 g/mol. Its IUPAC name is (5-chloro-2,3,4-trimethoxyphenyl)-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]methanone.
| Compound Name | (5-chloro-2,3,4-trimethoxyphenyl)-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]methanone |
|---|---|
| PubChem CID | 162630978 |
| Molecular Formula | C19H24ClNO6 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (5-chloro-2,3,4-trimethoxyphenyl)-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]methanone |
| SMILES | COc1c(Cl)cc(C(=O)N2C[C@H]3[C@@H](CO)[C@@H]4CC[C@@]3(C2)O4)c(OC)c1OC |
| InChI | InChI=1S/C19H24ClNO6/c1-24-15-10(6-13(20)16(25-2)17(15)26-3)18(23)21-7-12-11(8-22)14-4-5-19(12,9-21)27-14/h6,11-12,14,22H,4-5,7-9H2,1-3H3/t11-,12+,14+,19+/m1/s1 |
| InChIKey | AWNCZDMUQBGVGS-XOMVMTSMSA-N |
| XLogP | 1.98 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |