C19H26ClNO6 — CID 155940332
[(1S,5S,6R,7R)-3-[(2-chloro-3,4-dimethoxyphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol;formic acid (PubChem CID 155940332) has the molecular formula C19H26ClNO6 and a molecular weight of 399.87 g/mol. Its IUPAC name is [(1S,5S,6R,7R)-3-[(2-chloro-3,4-dimethoxyphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol;formic acid.
| Compound Name | [(1S,5S,6R,7R)-3-[(2-chloro-3,4-dimethoxyphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol;formic acid |
|---|---|
| PubChem CID | 155940332 |
| Molecular Formula | C19H26ClNO6 |
| Molecular Weight | 399.87 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | [(1S,5S,6R,7R)-3-[(2-chloro-3,4-dimethoxyphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol;formic acid |
| SMILES | COc1ccc(CN2C[C@@H]3[C@H](CO)[C@H]4CC[C@]3(C2)O4)c(Cl)c1OC.O=CO |
| InChI | InChI=1S/C18H24ClNO4.CH2O2/c1-22-15-4-3-11(16(19)17(15)23-2)7-20-8-13-12(9-21)14-5-6-18(13,10-20)24-14;2-1-3/h3-4,12-14,21H,5-10H2,1-2H3;1H,(H,2,3)/t12-,13+,14+,18+;/m0./s1 |
| InChIKey | BJAWTNPUDPGSAE-DRGROHHNSA-N |
| XLogP | 2.03 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.87 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|