C17H23N5O2S — CID 155500194
2-[(3S,7S,8aS)-7-(thieno[2,3-d]pyrimidin-4-ylamino)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]-N,N-dimethylacetamide (PubChem CID 155500194) has the molecular formula C17H23N5O2S and a molecular weight of 361.47 g/mol. Its IUPAC name is 2-[(3S,7S,8aS)-7-(thieno[2,3-d]pyrimidin-4-ylamino)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(3S,7S,8aS)-7-(thieno[2,3-d]pyrimidin-4-ylamino)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 155500194 |
| Molecular Formula | C17H23N5O2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-[(3S,7S,8aS)-7-(thieno[2,3-d]pyrimidin-4-ylamino)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C[C@H]1CN2C[C@@H](Nc3ncnc4sccc34)C[C@H]2CO1 |
| InChI | InChI=1S/C17H23N5O2S/c1-21(2)15(23)6-13-8-22-7-11(5-12(22)9-24-13)20-16-14-3-4-25-17(14)19-10-18-16/h3-4,10-13H,5-9H2,1-2H3,(H,18,19,20)/t11-,12-,13-/m0/s1 |
| InChIKey | VHWAZBBBXLELNB-AVGNSLFASA-N |
| XLogP | 1.42 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |