C20H17N3O4S — CID 155511066
4-[[2-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanylpyrimidin-4-yl]amino]benzoic acid (PubChem CID 155511066) has the molecular formula C20H17N3O4S and a molecular weight of 395.44 g/mol. Its IUPAC name is 4-[[2-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanylpyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[2-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanylpyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 155511066 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 4-[[2-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanylpyrimidin-4-yl]amino]benzoic acid |
| SMILES | COc1ccc(C(=O)CSc2nccc(Nc3ccc(C(=O)O)cc3)n2)cc1 |
| InChI | InChI=1S/C20H17N3O4S/c1-27-16-8-4-13(5-9-16)17(24)12-28-20-21-11-10-18(23-20)22-15-6-2-14(3-7-15)19(25)26/h2-11H,12H2,1H3,(H,25,26)(H,21,22,23) |
| InChIKey | QAFSVFWJTPHJPW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |