C29H32N4O5 — CID 155511410
(3S)-N-benzyl-3-[[(2S)-2-cyclopropyl-2-[[(E)-3-phenylprop-2-enoyl]amino]acetyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide (PubChem CID 155511410) has the molecular formula C29H32N4O5 and a molecular weight of 516.60 g/mol. Its IUPAC name is (3S)-N-benzyl-3-[[(2S)-2-cyclopropyl-2-[[(E)-3-phenylprop-2-enoyl]amino]acetyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide.
| Compound Name | (3S)-N-benzyl-3-[[(2S)-2-cyclopropyl-2-[[(E)-3-phenylprop-2-enoyl]amino]acetyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 155511410 |
| Molecular Formula | C29H32N4O5 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | (3S)-N-benzyl-3-[[(2S)-2-cyclopropyl-2-[[(E)-3-phenylprop-2-enoyl]amino]acetyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide |
| SMILES | O=C(/C=C/c1ccccc1)N[C@H](C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NCc1ccccc1)C1CC1 |
| InChI | InChI=1S/C29H32N4O5/c34-24(14-11-19-7-3-1-4-8-19)33-25(21-12-13-21)28(37)32-23(17-22-15-16-30-27(22)36)26(35)29(38)31-18-20-9-5-2-6-10-20/h1-11,14,21-23,25H,12-13,15-18H2,(H,30,36)(H,31,38)(H,32,37)(H,33,34)/b14-11+/t22-,23-,25-/m0/s1 |
| InChIKey | DNFVIYJAAVOUSZ-LHNJYRFESA-N |
| XLogP | 1.49 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|