C18H14Cl2FN3O2 — CID 155512995
4-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1H-pyridin-2-one (PubChem CID 155512995) has the molecular formula C18H14Cl2FN3O2 and a molecular weight of 394.23 g/mol. Its IUPAC name is 4-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1H-pyridin-2-one.
| Compound Name | 4-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 155512995 |
| Molecular Formula | C18H14Cl2FN3O2 |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 4-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1H-pyridin-2-one |
| SMILES | C[C@@H](Oc1cc(-c2cc[nH]c(=O)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C18H14Cl2FN3O2/c1-9(16-12(19)2-3-13(21)17(16)20)26-14-6-11(8-24-18(14)22)10-4-5-23-15(25)7-10/h2-9H,1H3,(H2,22,24)(H,23,25)/t9-/m1/s1 |
| InChIKey | QDIHRWAROZOBRH-SECBINFHSA-N |
| XLogP | 4.61 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|