C19H13N5 — CID 155513139
3-(3-pyrazolo[1,5-b]pyridazin-3-ylanilino)benzonitrile (PubChem CID 155513139) has the molecular formula C19H13N5 and a molecular weight of 311.35 g/mol. Its IUPAC name is 3-(3-pyrazolo[1,5-b]pyridazin-3-ylanilino)benzonitrile.
| Compound Name | 3-(3-pyrazolo[1,5-b]pyridazin-3-ylanilino)benzonitrile |
|---|---|
| PubChem CID | 155513139 |
| Molecular Formula | C19H13N5 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 3-(3-pyrazolo[1,5-b]pyridazin-3-ylanilino)benzonitrile |
| SMILES | N#Cc1cccc(Nc2cccc(-c3cnn4ncccc34)c2)c1 |
| InChI | InChI=1S/C19H13N5/c20-12-14-4-1-6-16(10-14)23-17-7-2-5-15(11-17)18-13-22-24-19(18)8-3-9-21-24/h1-11,13,23H |
| InChIKey | RYYFRPLGEOLZKY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |