C10H13NO2 — CID 155516672
6-cyclobutyl-1-hydroxy-4-methylpyridin-2-one (PubChem CID 155516672) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 6-cyclobutyl-1-hydroxy-4-methylpyridin-2-one.
| Compound Name | 6-cyclobutyl-1-hydroxy-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 155516672 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 6-cyclobutyl-1-hydroxy-4-methylpyridin-2-one |
| SMILES | Cc1cc(C2CCC2)n(O)c(=O)c1 |
| InChI | InChI=1S/C10H13NO2/c1-7-5-9(8-3-2-4-8)11(13)10(12)6-7/h5-6,8,13H,2-4H2,1H3 |
| InChIKey | SENKIYBFDNHIRX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|