C18H15N3OS — CID 155517058
N-(4-phenyl-1,3-thiazol-2-yl)-N-(pyridin-3-ylmethyl)prop-2-enamide (PubChem CID 155517058) has the molecular formula C18H15N3OS and a molecular weight of 321.41 g/mol. Its IUPAC name is N-(4-phenyl-1,3-thiazol-2-yl)-N-(pyridin-3-ylmethyl)prop-2-enamide.
| Compound Name | N-(4-phenyl-1,3-thiazol-2-yl)-N-(pyridin-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 155517058 |
| Molecular Formula | C18H15N3OS |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | N-(4-phenyl-1,3-thiazol-2-yl)-N-(pyridin-3-ylmethyl)prop-2-enamide |
| SMILES | C=CC(=O)N(Cc1cccnc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H15N3OS/c1-2-17(22)21(12-14-7-6-10-19-11-14)18-20-16(13-23-18)15-8-4-3-5-9-15/h2-11,13H,1,12H2 |
| InChIKey | LJBCAPRGGZPPHM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|