C41H45N7O3 — CID 155517609
N-[(2R)-5-(diaminomethylideneamino)-1-(4-phenyltriazol-1-yl)pentan-2-yl]-2-[1-[2-(3-methylbutoxy)naphthalen-1-yl]naphthalen-2-yl]oxyacetamide (PubChem CID 155517609) has the molecular formula C41H45N7O3 and a molecular weight of 683.86 g/mol. Its IUPAC name is N-[(2R)-5-(diaminomethylideneamino)-1-(4-phenyltriazol-1-yl)pentan-2-yl]-2-[1-[2-(3-methylbutoxy)naphthalen-1-yl]naphthalen-2-yl]oxyacetamide.
| Compound Name | N-[(2R)-5-(diaminomethylideneamino)-1-(4-phenyltriazol-1-yl)pentan-2-yl]-2-[1-[2-(3-methylbutoxy)naphthalen-1-yl]naphthalen-2-yl]oxyacetamide |
|---|---|
| PubChem CID | 155517609 |
| Molecular Formula | C41H45N7O3 |
| Molecular Weight | 683.86 g/mol |
| Exact Mass | 683.36 |
| IUPAC Name | N-[(2R)-5-(diaminomethylideneamino)-1-(4-phenyltriazol-1-yl)pentan-2-yl]-2-[1-[2-(3-methylbutoxy)naphthalen-1-yl]naphthalen-2-yl]oxyacetamide |
| SMILES | CC(C)CCOc1ccc2ccccc2c1-c1c(OCC(=O)N[C@H](CCCN=C(N)N)Cn2cc(-c3ccccc3)nn2)ccc2ccccc12 |
| InChI | InChI=1S/C41H45N7O3/c1-28(2)22-24-50-36-20-18-29-11-6-8-16-33(29)39(36)40-34-17-9-7-12-30(34)19-21-37(40)51-27-38(49)45-32(15-10-23-44-41(42)43)25-48-26-35(46-47-48)31-13-4-3-5-14-31/h3-9,11-14,16-21,26,28,32H,10,15,22-25,27H2,1-2H3,(H,45,49)(H4,42,43,44)/t32-/m1/s1 |
| InChIKey | QAQROOJJZGSHGJ-JGCGQSQUSA-N |
| XLogP | 6.96 |
| TPSA | 142.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.86 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|