C41H45N5O3 — CID 155539008
N-[(2R)-6-amino-1-[4-[[1-[2-(3-methylbutoxy)naphthalen-1-yl]naphthalen-2-yl]oxymethyl]triazol-1-yl]hexan-2-yl]benzamide (PubChem CID 155539008) has the molecular formula C41H45N5O3 and a molecular weight of 655.84 g/mol. Its IUPAC name is N-[(2R)-6-amino-1-[4-[[1-[2-(3-methylbutoxy)naphthalen-1-yl]naphthalen-2-yl]oxymethyl]triazol-1-yl]hexan-2-yl]benzamide.
| Compound Name | N-[(2R)-6-amino-1-[4-[[1-[2-(3-methylbutoxy)naphthalen-1-yl]naphthalen-2-yl]oxymethyl]triazol-1-yl]hexan-2-yl]benzamide |
|---|---|
| PubChem CID | 155539008 |
| Molecular Formula | C41H45N5O3 |
| Molecular Weight | 655.84 g/mol |
| Exact Mass | 655.35 |
| IUPAC Name | N-[(2R)-6-amino-1-[4-[[1-[2-(3-methylbutoxy)naphthalen-1-yl]naphthalen-2-yl]oxymethyl]triazol-1-yl]hexan-2-yl]benzamide |
| SMILES | CC(C)CCOc1ccc2ccccc2c1-c1c(OCc2cn(C[C@@H](CCCCN)NC(=O)c3ccccc3)nn2)ccc2ccccc12 |
| InChI | InChI=1S/C41H45N5O3/c1-29(2)23-25-48-37-21-19-30-12-6-8-17-35(30)39(37)40-36-18-9-7-13-31(36)20-22-38(40)49-28-34-27-46(45-44-34)26-33(16-10-11-24-42)43-41(47)32-14-4-3-5-15-32/h3-9,12-15,17-22,27,29,33H,10-11,16,23-26,28,42H2,1-2H3,(H,43,47)/t33-/m1/s1 |
| InChIKey | JYXRKXSXXIAVQT-MGBGTMOVSA-N |
| XLogP | 8.18 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.84 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|