C42H47N5O3 — CID 155565525
N-[(2R)-6-amino-1-[4-[[1-[2-(3-methylbutoxy)naphthalen-1-yl]naphthalen-2-yl]oxymethyl]triazol-1-yl]hexan-2-yl]-2-phenylacetamide (PubChem CID 155565525) has the molecular formula C42H47N5O3 and a molecular weight of 669.87 g/mol. Its IUPAC name is N-[(2R)-6-amino-1-[4-[[1-[2-(3-methylbutoxy)naphthalen-1-yl]naphthalen-2-yl]oxymethyl]triazol-1-yl]hexan-2-yl]-2-phenylacetamide.
| Compound Name | N-[(2R)-6-amino-1-[4-[[1-[2-(3-methylbutoxy)naphthalen-1-yl]naphthalen-2-yl]oxymethyl]triazol-1-yl]hexan-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 155565525 |
| Molecular Formula | C42H47N5O3 |
| Molecular Weight | 669.87 g/mol |
| Exact Mass | 669.37 |
| IUPAC Name | N-[(2R)-6-amino-1-[4-[[1-[2-(3-methylbutoxy)naphthalen-1-yl]naphthalen-2-yl]oxymethyl]triazol-1-yl]hexan-2-yl]-2-phenylacetamide |
| SMILES | CC(C)CCOc1ccc2ccccc2c1-c1c(OCc2cn(C[C@@H](CCCCN)NC(=O)Cc3ccccc3)nn2)ccc2ccccc12 |
| InChI | InChI=1S/C42H47N5O3/c1-30(2)23-25-49-38-21-19-32-14-6-8-17-36(32)41(38)42-37-18-9-7-15-33(37)20-22-39(42)50-29-35-28-47(46-45-35)27-34(16-10-11-24-43)44-40(48)26-31-12-4-3-5-13-31/h3-9,12-15,17-22,28,30,34H,10-11,16,23-27,29,43H2,1-2H3,(H,44,48)/t34-/m1/s1 |
| InChIKey | AGBYJJJXXOCBQO-UUWRZZSWSA-N |
| XLogP | 8.11 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.87 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|