C27H22ClN5O3 — CID 155518000
4-[[6-chloro-2-[4-(prop-2-enoylamino)phenyl]pyrimidin-4-yl]amino]-N-(4-methoxyphenyl)benzamide (PubChem CID 155518000) has the molecular formula C27H22ClN5O3 and a molecular weight of 499.96 g/mol. Its IUPAC name is 4-[[6-chloro-2-[4-(prop-2-enoylamino)phenyl]pyrimidin-4-yl]amino]-N-(4-methoxyphenyl)benzamide.
| Compound Name | 4-[[6-chloro-2-[4-(prop-2-enoylamino)phenyl]pyrimidin-4-yl]amino]-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 155518000 |
| Molecular Formula | C27H22ClN5O3 |
| Molecular Weight | 499.96 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 4-[[6-chloro-2-[4-(prop-2-enoylamino)phenyl]pyrimidin-4-yl]amino]-N-(4-methoxyphenyl)benzamide |
| SMILES | C=CC(=O)Nc1ccc(-c2nc(Cl)cc(Nc3ccc(C(=O)Nc4ccc(OC)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C27H22ClN5O3/c1-3-25(34)30-20-8-4-17(5-9-20)26-32-23(28)16-24(33-26)29-19-10-6-18(7-11-19)27(35)31-21-12-14-22(36-2)15-13-21/h3-16H,1H2,2H3,(H,30,34)(H,31,35)(H,29,32,33) |
| InChIKey | JYDHVDYQHDGIEG-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.96 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|