C20H23Cl2NO4S — CID 155518666
(2R,3R,4S,5R,6R)-2-(3,4-dichlorophenyl)sulfanyl-4-(3,4-dimethylanilino)-6-(hydroxymethyl)oxane-3,5-diol (PubChem CID 155518666) has the molecular formula C20H23Cl2NO4S and a molecular weight of 444.38 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(3,4-dichlorophenyl)sulfanyl-4-(3,4-dimethylanilino)-6-(hydroxymethyl)oxane-3,5-diol.
| Compound Name | (2R,3R,4S,5R,6R)-2-(3,4-dichlorophenyl)sulfanyl-4-(3,4-dimethylanilino)-6-(hydroxymethyl)oxane-3,5-diol |
|---|---|
| PubChem CID | 155518666 |
| Molecular Formula | C20H23Cl2NO4S |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(3,4-dichlorophenyl)sulfanyl-4-(3,4-dimethylanilino)-6-(hydroxymethyl)oxane-3,5-diol |
| SMILES | Cc1ccc(N[C@@H]2[C@@H](O)[C@@H](Sc3ccc(Cl)c(Cl)c3)O[C@H](CO)[C@@H]2O)cc1C |
| InChI | InChI=1S/C20H23Cl2NO4S/c1-10-3-4-12(7-11(10)2)23-17-18(25)16(9-24)27-20(19(17)26)28-13-5-6-14(21)15(22)8-13/h3-8,16-20,23-26H,9H2,1-2H3/t16-,17+,18+,19-,20-/m1/s1 |
| InChIKey | KXTYJQDZYPOHLD-LCWAXJCOSA-N |
| XLogP | 3.62 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |