C18H16ClN3O2S — CID 155519709
N-(4-chloro-1,3-benzothiazol-2-yl)-4-morpholin-4-ylbenzamide (PubChem CID 155519709) has the molecular formula C18H16ClN3O2S and a molecular weight of 373.87 g/mol. Its IUPAC name is N-(4-chloro-1,3-benzothiazol-2-yl)-4-morpholin-4-ylbenzamide.
| Compound Name | N-(4-chloro-1,3-benzothiazol-2-yl)-4-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 155519709 |
| Molecular Formula | C18H16ClN3O2S |
| Molecular Weight | 373.87 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | N-(4-chloro-1,3-benzothiazol-2-yl)-4-morpholin-4-ylbenzamide |
| SMILES | O=C(Nc1nc2c(Cl)cccc2s1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H16ClN3O2S/c19-14-2-1-3-15-16(14)20-18(25-15)21-17(23)12-4-6-13(7-5-12)22-8-10-24-11-9-22/h1-7H,8-11H2,(H,20,21,23) |
| InChIKey | URLMJMRDTLDHLG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.87 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |