C27H30N2O — CID 155521235
(12aS)-7,7,9,12a-tetramethyl-2-phenylmethoxy-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline (PubChem CID 155521235) has the molecular formula C27H30N2O and a molecular weight of 398.55 g/mol. Its IUPAC name is (12aS)-7,7,9,12a-tetramethyl-2-phenylmethoxy-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline.
| Compound Name | (12aS)-7,7,9,12a-tetramethyl-2-phenylmethoxy-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline |
|---|---|
| PubChem CID | 155521235 |
| Molecular Formula | C27H30N2O |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | (12aS)-7,7,9,12a-tetramethyl-2-phenylmethoxy-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline |
| SMILES | Cc1ncc2c(n1)C(C)(C)C1CCc3ccc(OCc4ccccc4)cc3[C@@]1(C)C2 |
| InChI | InChI=1S/C27H30N2O/c1-18-28-16-21-15-27(4)23-14-22(30-17-19-8-6-5-7-9-19)12-10-20(23)11-13-24(27)26(2,3)25(21)29-18/h5-10,12,14,16,24H,11,13,15,17H2,1-4H3/t24?,27-/m1/s1 |
| InChIKey | BCTFDKXKJBRJJX-LFHRXCRSSA-N |
| XLogP | 5.72 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |