C18H15ClN2O4S — CID 155523913
3'-(4-chlorophenyl)sulfonylspiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 155523913) has the molecular formula C18H15ClN2O4S and a molecular weight of 390.85 g/mol. Its IUPAC name is 3'-(4-chlorophenyl)sulfonylspiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 3'-(4-chlorophenyl)sulfonylspiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 155523913 |
| Molecular Formula | C18H15ClN2O4S |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 3'-(4-chlorophenyl)sulfonylspiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC2(CCCc3ccccc32)C(=O)N1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15ClN2O4S/c19-13-7-9-14(10-8-13)26(24,25)21-16(22)18(20-17(21)23)11-3-5-12-4-1-2-6-15(12)18/h1-2,4,6-10H,3,5,11H2,(H,20,23) |
| InChIKey | WWNWSLZCQVQJTE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|