C20H25N3O — CID 155524100
(9S)-9-(cyclohexylmethyl)-2-phenyl-5,6,8,9-tetrahydroimidazo[1,2-a][1,4]diazepin-7-one (PubChem CID 155524100) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is (9S)-9-(cyclohexylmethyl)-2-phenyl-5,6,8,9-tetrahydroimidazo[1,2-a][1,4]diazepin-7-one.
| Compound Name | (9S)-9-(cyclohexylmethyl)-2-phenyl-5,6,8,9-tetrahydroimidazo[1,2-a][1,4]diazepin-7-one |
|---|---|
| PubChem CID | 155524100 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (9S)-9-(cyclohexylmethyl)-2-phenyl-5,6,8,9-tetrahydroimidazo[1,2-a][1,4]diazepin-7-one |
| SMILES | O=C1CCn2cc(-c3ccccc3)nc2[C@H](CC2CCCCC2)N1 |
| InChI | InChI=1S/C20H25N3O/c24-19-11-12-23-14-18(16-9-5-2-6-10-16)22-20(23)17(21-19)13-15-7-3-1-4-8-15/h2,5-6,9-10,14-15,17H,1,3-4,7-8,11-13H2,(H,21,24)/t17-/m0/s1 |
| InChIKey | KRSTWDNPODDYAS-KRWDZBQOSA-N |
| XLogP | 4.08 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |