C25H26N2O2 — CID 155524573
1-[4-[(1R)-1-(dimethylamino)ethyl]phenyl]-2-hydroxy-4,9-dimethyl-5H-phenanthridin-6-one (PubChem CID 155524573) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-[4-[(1R)-1-(dimethylamino)ethyl]phenyl]-2-hydroxy-4,9-dimethyl-5H-phenanthridin-6-one.
| Compound Name | 1-[4-[(1R)-1-(dimethylamino)ethyl]phenyl]-2-hydroxy-4,9-dimethyl-5H-phenanthridin-6-one |
|---|---|
| PubChem CID | 155524573 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1-[4-[(1R)-1-(dimethylamino)ethyl]phenyl]-2-hydroxy-4,9-dimethyl-5H-phenanthridin-6-one |
| SMILES | Cc1ccc2c(=O)[nH]c3c(C)cc(O)c(-c4ccc([C@@H](C)N(C)C)cc4)c3c2c1 |
| InChI | InChI=1S/C25H26N2O2/c1-14-6-11-19-20(12-14)23-22(21(28)13-15(2)24(23)26-25(19)29)18-9-7-17(8-10-18)16(3)27(4)5/h6-13,16,28H,1-5H3,(H,26,29)/t16-/m1/s1 |
| InChIKey | GKRJEKYPYKMFPJ-MRXNPFEDSA-N |
| XLogP | 5.29 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|