C25H25N7O3 — CID 155525309
2-[[2-[2-methoxy-5-[(prop-2-enoylamino)methyl]anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-N-methylbenzamide (PubChem CID 155525309) has the molecular formula C25H25N7O3 and a molecular weight of 471.52 g/mol. Its IUPAC name is 2-[[2-[2-methoxy-5-[(prop-2-enoylamino)methyl]anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-N-methylbenzamide.
| Compound Name | 2-[[2-[2-methoxy-5-[(prop-2-enoylamino)methyl]anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 155525309 |
| Molecular Formula | C25H25N7O3 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 2-[[2-[2-methoxy-5-[(prop-2-enoylamino)methyl]anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-N-methylbenzamide |
| SMILES | C=CC(=O)NCc1ccc(OC)c(Nc2nc(Nc3ccccc3C(=O)NC)c3cc[nH]c3n2)c1 |
| InChI | InChI=1S/C25H25N7O3/c1-4-21(33)28-14-15-9-10-20(35-3)19(13-15)30-25-31-22-17(11-12-27-22)23(32-25)29-18-8-6-5-7-16(18)24(34)26-2/h4-13H,1,14H2,2-3H3,(H,26,34)(H,28,33)(H3,27,29,30,31,32) |
| InChIKey | LBDQNZXQCZAHPP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 133.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|