C24H26N8O3 — CID 59442086
2-[[2-[5-[[2-(dimethylamino)acetyl]amino]-2-methylanilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-N-hydroxybenzamide (PubChem CID 59442086) has the molecular formula C24H26N8O3 and a molecular weight of 474.53 g/mol. Its IUPAC name is 2-[[2-[5-[[2-(dimethylamino)acetyl]amino]-2-methylanilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-N-hydroxybenzamide.
| Compound Name | 2-[[2-[5-[[2-(dimethylamino)acetyl]amino]-2-methylanilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 59442086 |
| Molecular Formula | C24H26N8O3 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 2-[[2-[5-[[2-(dimethylamino)acetyl]amino]-2-methylanilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-N-hydroxybenzamide |
| SMILES | Cc1ccc(NC(=O)CN(C)C)cc1Nc1nc(Nc2ccccc2C(=O)NO)c2cc[nH]c2n1 |
| InChI | InChI=1S/C24H26N8O3/c1-14-8-9-15(26-20(33)13-32(2)3)12-19(14)28-24-29-21-17(10-11-25-21)22(30-24)27-18-7-5-4-6-16(18)23(34)31-35/h4-12,35H,13H2,1-3H3,(H,26,33)(H,31,34)(H3,25,27,28,29,30) |
| InChIKey | DACXUIVSGAZKJQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 147.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|