C20H23N3O3 — CID 155526002
(3R,5S)-5-[[(2E)-2-[(3-phenoxyphenyl)methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid (PubChem CID 155526002) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is (3R,5S)-5-[[(2E)-2-[(3-phenoxyphenyl)methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,5S)-5-[[(2E)-2-[(3-phenoxyphenyl)methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155526002 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (3R,5S)-5-[[(2E)-2-[(3-phenoxyphenyl)methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CNC[C@@H](CN/N=C/c2cccc(Oc3ccccc3)c2)C1 |
| InChI | InChI=1S/C20H23N3O3/c24-20(25)17-9-16(11-21-14-17)13-23-22-12-15-5-4-8-19(10-15)26-18-6-2-1-3-7-18/h1-8,10,12,16-17,21,23H,9,11,13-14H2,(H,24,25)/b22-12+/t16-,17+/m0/s1 |
| InChIKey | BNMAHCSESGTYQC-JDDWRULVSA-N |
| XLogP | 2.71 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|