C17H20ClN3O3 — CID 155528084
ethyl 6-chloro-3-[(E)-(pentanoylhydrazinylidene)methyl]-1H-indole-2-carboxylate (PubChem CID 155528084) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is ethyl 6-chloro-3-[(E)-(pentanoylhydrazinylidene)methyl]-1H-indole-2-carboxylate.
| Compound Name | ethyl 6-chloro-3-[(E)-(pentanoylhydrazinylidene)methyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 155528084 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | ethyl 6-chloro-3-[(E)-(pentanoylhydrazinylidene)methyl]-1H-indole-2-carboxylate |
| SMILES | CCCCC(=O)N/N=C/c1c(C(=O)OCC)[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C17H20ClN3O3/c1-3-5-6-15(22)21-19-10-13-12-8-7-11(18)9-14(12)20-16(13)17(23)24-4-2/h7-10,20H,3-6H2,1-2H3,(H,21,22)/b19-10+ |
| InChIKey | RAPWSDYQWIIAOM-VXLYETTFSA-N |
| XLogP | 3.64 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|