C23H20Cl2N2O5 — CID 158792265
ethyl 6-chloro-3-formyl-1H-indole-2-carboxylate;ethyl 6-chloro-1H-indole-2-carboxylate (PubChem CID 158792265) has the molecular formula C23H20Cl2N2O5 and a molecular weight of 475.33 g/mol. Its IUPAC name is ethyl 6-chloro-3-formyl-1H-indole-2-carboxylate;ethyl 6-chloro-1H-indole-2-carboxylate.
| Compound Name | ethyl 6-chloro-3-formyl-1H-indole-2-carboxylate;ethyl 6-chloro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 158792265 |
| Molecular Formula | C23H20Cl2N2O5 |
| Molecular Weight | 475.33 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | ethyl 6-chloro-3-formyl-1H-indole-2-carboxylate;ethyl 6-chloro-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2cc(Cl)ccc2c1C=O.CCOC(=O)c1cc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C12H10ClNO3.C11H10ClNO2/c1-2-17-12(16)11-9(6-15)8-4-3-7(13)5-10(8)14-11;1-2-15-11(14)10-5-7-3-4-8(12)6-9(7)13-10/h3-6,14H,2H2,1H3;3-6,13H,2H2,1H3 |
| InChIKey | ISKTYRKMGYVKNA-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 101.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.33 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|