C21H23NO5 — CID 155528998
5-amino-6-methoxy-2-[(3,4,5-trimethoxyphenyl)methyl]naphthalen-1-ol (PubChem CID 155528998) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is 5-amino-6-methoxy-2-[(3,4,5-trimethoxyphenyl)methyl]naphthalen-1-ol.
| Compound Name | 5-amino-6-methoxy-2-[(3,4,5-trimethoxyphenyl)methyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 155528998 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 5-amino-6-methoxy-2-[(3,4,5-trimethoxyphenyl)methyl]naphthalen-1-ol |
| SMILES | COc1cc(Cc2ccc3c(N)c(OC)ccc3c2O)cc(OC)c1OC |
| InChI | InChI=1S/C21H23NO5/c1-24-16-8-7-15-14(19(16)22)6-5-13(20(15)23)9-12-10-17(25-2)21(27-4)18(11-12)26-3/h5-8,10-11,23H,9,22H2,1-4H3 |
| InChIKey | XAAWNAIVKBOLBZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|