C12H11IN4S3 — CID 155531659
1-(4-iodophenyl)-3-(3-prop-2-enylsulfanyl-1,2,4-thiadiazol-5-yl)thiourea (PubChem CID 155531659) has the molecular formula C12H11IN4S3 and a molecular weight of 434.35 g/mol. Its IUPAC name is 1-(4-iodophenyl)-3-(3-prop-2-enylsulfanyl-1,2,4-thiadiazol-5-yl)thiourea.
| Compound Name | 1-(4-iodophenyl)-3-(3-prop-2-enylsulfanyl-1,2,4-thiadiazol-5-yl)thiourea |
|---|---|
| PubChem CID | 155531659 |
| Molecular Formula | C12H11IN4S3 |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 433.92 |
| IUPAC Name | 1-(4-iodophenyl)-3-(3-prop-2-enylsulfanyl-1,2,4-thiadiazol-5-yl)thiourea |
| SMILES | C=CCSc1nsc(NC(=S)Nc2ccc(I)cc2)n1 |
| InChI | InChI=1S/C12H11IN4S3/c1-2-7-19-12-16-11(20-17-12)15-10(18)14-9-5-3-8(13)4-6-9/h2-6H,1,7H2,(H2,14,15,16,17,18) |
| InChIKey | PCCJTDUAJXRJCJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|