C25H31N5O5S — CID 155531896
(2S)-N'-tert-butyl-N-[2-[(3-cyanobenzoyl)amino]ethyl]-2-[(4-methylphenyl)sulfonylamino]butanediamide (PubChem CID 155531896) has the molecular formula C25H31N5O5S and a molecular weight of 513.62 g/mol. Its IUPAC name is (2S)-N'-tert-butyl-N-[2-[(3-cyanobenzoyl)amino]ethyl]-2-[(4-methylphenyl)sulfonylamino]butanediamide.
| Compound Name | (2S)-N'-tert-butyl-N-[2-[(3-cyanobenzoyl)amino]ethyl]-2-[(4-methylphenyl)sulfonylamino]butanediamide |
|---|---|
| PubChem CID | 155531896 |
| Molecular Formula | C25H31N5O5S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | (2S)-N'-tert-butyl-N-[2-[(3-cyanobenzoyl)amino]ethyl]-2-[(4-methylphenyl)sulfonylamino]butanediamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CC(=O)NC(C)(C)C)C(=O)NCCNC(=O)c2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C25H31N5O5S/c1-17-8-10-20(11-9-17)36(34,35)30-21(15-22(31)29-25(2,3)4)24(33)28-13-12-27-23(32)19-7-5-6-18(14-19)16-26/h5-11,14,21,30H,12-13,15H2,1-4H3,(H,27,32)(H,28,33)(H,29,31)/t21-/m0/s1 |
| InChIKey | PTZGUXXLZVHWFC-NRFANRHFSA-N |
| XLogP | 1.36 |
| TPSA | 157.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|