C25H35N5O5S — CID 155535430
(2S)-N-[2-(benzylcarbamoylamino)ethyl]-N'-tert-butyl-2-[(4-methylphenyl)sulfonylamino]butanediamide (PubChem CID 155535430) has the molecular formula C25H35N5O5S and a molecular weight of 517.65 g/mol. Its IUPAC name is (2S)-N-[2-(benzylcarbamoylamino)ethyl]-N'-tert-butyl-2-[(4-methylphenyl)sulfonylamino]butanediamide.
| Compound Name | (2S)-N-[2-(benzylcarbamoylamino)ethyl]-N'-tert-butyl-2-[(4-methylphenyl)sulfonylamino]butanediamide |
|---|---|
| PubChem CID | 155535430 |
| Molecular Formula | C25H35N5O5S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | (2S)-N-[2-(benzylcarbamoylamino)ethyl]-N'-tert-butyl-2-[(4-methylphenyl)sulfonylamino]butanediamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CC(=O)NC(C)(C)C)C(=O)NCCNC(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H35N5O5S/c1-18-10-12-20(13-11-18)36(34,35)30-21(16-22(31)29-25(2,3)4)23(32)26-14-15-27-24(33)28-17-19-8-6-5-7-9-19/h5-13,21,30H,14-17H2,1-4H3,(H,26,32)(H,29,31)(H2,27,28,33)/t21-/m0/s1 |
| InChIKey | DWIGHVPDBUWLCE-NRFANRHFSA-N |
| XLogP | 1.56 |
| TPSA | 145.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|