C24H31N3O6S — CID 129048043
(2S)-N'-tert-butyl-N-[2-[(2-hydroxybenzoyl)amino]ethyl]-2-(4-methylphenyl)sulfonylbutanediamide (PubChem CID 129048043) has the molecular formula C24H31N3O6S and a molecular weight of 489.59 g/mol. Its IUPAC name is (2S)-N'-tert-butyl-N-[2-[(2-hydroxybenzoyl)amino]ethyl]-2-(4-methylphenyl)sulfonylbutanediamide.
| Compound Name | (2S)-N'-tert-butyl-N-[2-[(2-hydroxybenzoyl)amino]ethyl]-2-(4-methylphenyl)sulfonylbutanediamide |
|---|---|
| PubChem CID | 129048043 |
| Molecular Formula | C24H31N3O6S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | (2S)-N'-tert-butyl-N-[2-[(2-hydroxybenzoyl)amino]ethyl]-2-(4-methylphenyl)sulfonylbutanediamide |
| SMILES | Cc1ccc(S(=O)(=O)C(CC(=O)NC(C)(C)C)C(=O)NCCNC(=O)c2ccccc2O)cc1 |
| InChI | InChI=1S/C24H31N3O6S/c1-16-9-11-17(12-10-16)34(32,33)20(15-21(29)27-24(2,3)4)23(31)26-14-13-25-22(30)18-7-5-6-8-19(18)28/h5-12,20,28H,13-15H2,1-4H3,(H,25,30)(H,26,31)(H,27,29) |
| InChIKey | HTKGMJBMXXYMEI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|