C26H29FN8O — CID 155532106
(2R)-N-[3-[2-[(2-fluoro-3-pyridinyl)amino]-5-methylpyrimidin-4-yl]-1H-indol-7-yl]-2-(4-methylpiperazin-1-yl)propanamide (PubChem CID 155532106) has the molecular formula C26H29FN8O and a molecular weight of 488.57 g/mol. Its IUPAC name is (2R)-N-[3-[2-[(2-fluoro-3-pyridinyl)amino]-5-methylpyrimidin-4-yl]-1H-indol-7-yl]-2-(4-methylpiperazin-1-yl)propanamide.
| Compound Name | (2R)-N-[3-[2-[(2-fluoro-3-pyridinyl)amino]-5-methylpyrimidin-4-yl]-1H-indol-7-yl]-2-(4-methylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 155532106 |
| Molecular Formula | C26H29FN8O |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | (2R)-N-[3-[2-[(2-fluoro-3-pyridinyl)amino]-5-methylpyrimidin-4-yl]-1H-indol-7-yl]-2-(4-methylpiperazin-1-yl)propanamide |
| SMILES | Cc1cnc(Nc2cccnc2F)nc1-c1c[nH]c2c(NC(=O)[C@@H](C)N3CCN(C)CC3)cccc12 |
| InChI | InChI=1S/C26H29FN8O/c1-16-14-30-26(32-21-8-5-9-28-24(21)27)33-22(16)19-15-29-23-18(19)6-4-7-20(23)31-25(36)17(2)35-12-10-34(3)11-13-35/h4-9,14-15,17,29H,10-13H2,1-3H3,(H,31,36)(H,30,32,33)/t17-/m1/s1 |
| InChIKey | YTXXSESRXPGXSC-QGZVFWFLSA-N |
| XLogP | 3.79 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|