C27H26N2O4 — CID 155532314
diethyl 1-benzyl-4-quinolin-3-yl-4H-pyridine-3,5-dicarboxylate (PubChem CID 155532314) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is diethyl 1-benzyl-4-quinolin-3-yl-4H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 1-benzyl-4-quinolin-3-yl-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 155532314 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | diethyl 1-benzyl-4-quinolin-3-yl-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=CN(Cc2ccccc2)C=C(C(=O)OCC)C1c1cnc2ccccc2c1 |
| InChI | InChI=1S/C27H26N2O4/c1-3-32-26(30)22-17-29(16-19-10-6-5-7-11-19)18-23(27(31)33-4-2)25(22)21-14-20-12-8-9-13-24(20)28-15-21/h5-15,17-18,25H,3-4,16H2,1-2H3 |
| InChIKey | BATUDIXWIVLCDO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |