C21H17ClFNO3 — CID 155532890
4-[[1-[(4-chlorophenyl)methyl]-5-fluoroindol-3-yl]-hydroxymethyl]-3-methylideneoxolan-2-one (PubChem CID 155532890) has the molecular formula C21H17ClFNO3 and a molecular weight of 385.82 g/mol. Its IUPAC name is 4-[[1-[(4-chlorophenyl)methyl]-5-fluoroindol-3-yl]-hydroxymethyl]-3-methylideneoxolan-2-one.
| Compound Name | 4-[[1-[(4-chlorophenyl)methyl]-5-fluoroindol-3-yl]-hydroxymethyl]-3-methylideneoxolan-2-one |
|---|---|
| PubChem CID | 155532890 |
| Molecular Formula | C21H17ClFNO3 |
| Molecular Weight | 385.82 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 4-[[1-[(4-chlorophenyl)methyl]-5-fluoroindol-3-yl]-hydroxymethyl]-3-methylideneoxolan-2-one |
| SMILES | C=C1C(=O)OCC1C(O)c1cn(Cc2ccc(Cl)cc2)c2ccc(F)cc12 |
| InChI | InChI=1S/C21H17ClFNO3/c1-12-18(11-27-21(12)26)20(25)17-10-24(9-13-2-4-14(22)5-3-13)19-7-6-15(23)8-16(17)19/h2-8,10,18,20,25H,1,9,11H2 |
| InChIKey | XQQGCELVBDUHMT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.82 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|