C35H27N7O6S — CID 155534316
4-[[4-[2-(6-benzyl-13-methyl-8-oxa-4-thia-1,11,12-triazatricyclo[8.3.0.03,7]trideca-3(7),5,10,12-tetraen-5-yl)ethynyl]pyrazol-1-yl]methoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 155534316) has the molecular formula C35H27N7O6S and a molecular weight of 673.71 g/mol. Its IUPAC name is 4-[[4-[2-(6-benzyl-13-methyl-8-oxa-4-thia-1,11,12-triazatricyclo[8.3.0.03,7]trideca-3(7),5,10,12-tetraen-5-yl)ethynyl]pyrazol-1-yl]methoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[4-[2-(6-benzyl-13-methyl-8-oxa-4-thia-1,11,12-triazatricyclo[8.3.0.03,7]trideca-3(7),5,10,12-tetraen-5-yl)ethynyl]pyrazol-1-yl]methoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 155534316 |
| Molecular Formula | C35H27N7O6S |
| Molecular Weight | 673.71 g/mol |
| Exact Mass | 673.17 |
| IUPAC Name | 4-[[4-[2-(6-benzyl-13-methyl-8-oxa-4-thia-1,11,12-triazatricyclo[8.3.0.03,7]trideca-3(7),5,10,12-tetraen-5-yl)ethynyl]pyrazol-1-yl]methoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | Cc1nnc2n1Cc1sc(C#Cc3cnn(COc4cccc5c4C(=O)N(C4CCC(=O)NC4=O)C5=O)c3)c(Cc3ccccc3)c1OC2 |
| InChI | InChI=1S/C35H27N7O6S/c1-20-38-39-29-18-47-32-24(14-21-6-3-2-4-7-21)27(49-28(32)17-41(20)29)12-10-22-15-36-40(16-22)19-48-26-9-5-8-23-31(26)35(46)42(34(23)45)25-11-13-30(43)37-33(25)44/h2-9,15-16,25H,11,13-14,17-19H2,1H3,(H,37,43,44) |
| InChIKey | ORVYTTDEFNCABB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.71 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|