C15H24N6 — CID 155534519
2-N-(2,2-dimethylpropyl)-4-N-[3-(1H-imidazol-5-yl)propyl]pyrimidine-2,4-diamine (PubChem CID 155534519) has the molecular formula C15H24N6 and a molecular weight of 288.40 g/mol. Its IUPAC name is 2-N-(2,2-dimethylpropyl)-4-N-[3-(1H-imidazol-5-yl)propyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2,2-dimethylpropyl)-4-N-[3-(1H-imidazol-5-yl)propyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 155534519 |
| Molecular Formula | C15H24N6 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 2-N-(2,2-dimethylpropyl)-4-N-[3-(1H-imidazol-5-yl)propyl]pyrimidine-2,4-diamine |
| SMILES | CC(C)(C)CNc1nccc(NCCCc2cnc[nH]2)n1 |
| InChI | InChI=1S/C15H24N6/c1-15(2,3)10-19-14-18-8-6-13(21-14)17-7-4-5-12-9-16-11-20-12/h6,8-9,11H,4-5,7,10H2,1-3H3,(H,16,20)(H2,17,18,19,21) |
| InChIKey | GHBUBJMRVNPMSE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|