C17H19BrN2O2 — CID 155535521
3-ethyl-2-methyl-1-propan-2-ylbenzo[f]benzimidazol-3-ium-4,9-dione bromide (PubChem CID 155535521) has the molecular formula C17H19BrN2O2 and a molecular weight of 363.26 g/mol. Its IUPAC name is 3-ethyl-2-methyl-1-propan-2-ylbenzo[f]benzimidazol-3-ium-4,9-dione bromide.
| Compound Name | 3-ethyl-2-methyl-1-propan-2-ylbenzo[f]benzimidazol-3-ium-4,9-dione bromide |
|---|---|
| PubChem CID | 155535521 |
| Molecular Formula | C17H19BrN2O2 |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 3-ethyl-2-methyl-1-propan-2-ylbenzo[f]benzimidazol-3-ium-4,9-dione bromide |
| SMILES | CC[n+]1c2c(n(C(C)C)c1C)C(=O)c1ccccc1C2=O.[Br-] |
| InChI | InChI=1S/C17H19N2O2.BrH/c1-5-18-11(4)19(10(2)3)15-14(18)16(20)12-8-6-7-9-13(12)17(15)21;/h6-10H,5H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | PRODKGSLUPRIRU-UHFFFAOYSA-M |
| XLogP | -0.54 |
| TPSA | 42.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|