C20H17ClN2O3 — CID 155536717
3-[4-(4-chlorophenyl)piperazin-1-yl]-4-hydroxynaphthalene-1,2-dione (PubChem CID 155536717) has the molecular formula C20H17ClN2O3 and a molecular weight of 368.82 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)piperazin-1-yl]-4-hydroxynaphthalene-1,2-dione.
| Compound Name | 3-[4-(4-chlorophenyl)piperazin-1-yl]-4-hydroxynaphthalene-1,2-dione |
|---|---|
| PubChem CID | 155536717 |
| Molecular Formula | C20H17ClN2O3 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 3-[4-(4-chlorophenyl)piperazin-1-yl]-4-hydroxynaphthalene-1,2-dione |
| SMILES | O=C1C(=O)c2ccccc2C(O)=C1N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H17ClN2O3/c21-13-5-7-14(8-6-13)22-9-11-23(12-10-22)17-18(24)15-3-1-2-4-16(15)19(25)20(17)26/h1-8,24H,9-12H2 |
| InChIKey | WTIZDVPURAOELU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|