C20H18N2O3 — CID 70681849
4-hydroxy-3-(4-phenylpiperazin-1-yl)naphthalene-1,2-dione (PubChem CID 70681849) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 4-hydroxy-3-(4-phenylpiperazin-1-yl)naphthalene-1,2-dione.
| Compound Name | 4-hydroxy-3-(4-phenylpiperazin-1-yl)naphthalene-1,2-dione |
|---|---|
| PubChem CID | 70681849 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 4-hydroxy-3-(4-phenylpiperazin-1-yl)naphthalene-1,2-dione |
| SMILES | O=C1C(=O)c2ccccc2C(O)=C1N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H18N2O3/c23-18-15-8-4-5-9-16(15)19(24)20(25)17(18)22-12-10-21(11-13-22)14-6-2-1-3-7-14/h1-9,23H,10-13H2 |
| InChIKey | JRTJURNLTNTIMG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|