C20H16Cl2N2O3 — CID 155567039
3-[4-(2,3-dichlorophenyl)piperazin-1-yl]-4-hydroxynaphthalene-1,2-dione (PubChem CID 155567039) has the molecular formula C20H16Cl2N2O3 and a molecular weight of 403.27 g/mol. Its IUPAC name is 3-[4-(2,3-dichlorophenyl)piperazin-1-yl]-4-hydroxynaphthalene-1,2-dione.
| Compound Name | 3-[4-(2,3-dichlorophenyl)piperazin-1-yl]-4-hydroxynaphthalene-1,2-dione |
|---|---|
| PubChem CID | 155567039 |
| Molecular Formula | C20H16Cl2N2O3 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 3-[4-(2,3-dichlorophenyl)piperazin-1-yl]-4-hydroxynaphthalene-1,2-dione |
| SMILES | O=C1C(=O)c2ccccc2C(O)=C1N1CCN(c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C20H16Cl2N2O3/c21-14-6-3-7-15(16(14)22)23-8-10-24(11-9-23)17-18(25)12-4-1-2-5-13(12)19(26)20(17)27/h1-7,25H,8-11H2 |
| InChIKey | ANFLCFHWXBTVQF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|