C24H36N2O4 — CID 155537839
ethyl (2S)-2-[[(2R)-1-[(2S)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate (PubChem CID 155537839) has the molecular formula C24H36N2O4 and a molecular weight of 416.56 g/mol. Its IUPAC name is ethyl (2S)-2-[[(2R)-1-[(2S)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate.
| Compound Name | ethyl (2S)-2-[[(2R)-1-[(2S)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 155537839 |
| Molecular Formula | C24H36N2O4 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | ethyl (2S)-2-[[(2R)-1-[(2S)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@H](C)C(=O)N1C2CCCCC2C[C@H]1CO |
| InChI | InChI=1S/C24H36N2O4/c1-3-30-24(29)21(14-13-18-9-5-4-6-10-18)25-17(2)23(28)26-20(16-27)15-19-11-7-8-12-22(19)26/h4-6,9-10,17,19-22,25,27H,3,7-8,11-16H2,1-2H3/t17-,19?,20+,21+,22?/m1/s1 |
| InChIKey | XJOZHTONLIVREV-AZEKMVAXSA-N |
| XLogP | 2.68 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |