C26H38N2O5 — CID 70323782
ethyl (2S)-2-[[(2S)-1-[2-(2-methoxy-2-oxoethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate (PubChem CID 70323782) has the molecular formula C26H38N2O5 and a molecular weight of 458.60 g/mol. Its IUPAC name is ethyl (2S)-2-[[(2S)-1-[2-(2-methoxy-2-oxoethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate.
| Compound Name | ethyl (2S)-2-[[(2S)-1-[2-(2-methoxy-2-oxoethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 70323782 |
| Molecular Formula | C26H38N2O5 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | ethyl (2S)-2-[[(2S)-1-[2-(2-methoxy-2-oxoethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N1C(CC(=O)OC)CC2CCCCC21 |
| InChI | InChI=1S/C26H38N2O5/c1-4-33-26(31)22(15-14-19-10-6-5-7-11-19)27-18(2)25(30)28-21(17-24(29)32-3)16-20-12-8-9-13-23(20)28/h5-7,10-11,18,20-23,27H,4,8-9,12-17H2,1-3H3/t18-,20?,21?,22-,23?/m0/s1 |
| InChIKey | GELBMPXUKBXKAB-IJUHMEGLSA-N |
| XLogP | 3.25 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |