C25H36N2O8 — CID 70398053
1,3-dihydroxypropan-2-yl (2S)-2-[[(2S)-1-[(2S,3aR,7aS)-2-carboxyoxy-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate (PubChem CID 70398053) has the molecular formula C25H36N2O8 and a molecular weight of 492.57 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl (2S)-2-[[(2S)-1-[(2S,3aR,7aS)-2-carboxyoxy-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate.
| Compound Name | 1,3-dihydroxypropan-2-yl (2S)-2-[[(2S)-1-[(2S,3aR,7aS)-2-carboxyoxy-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 70398053 |
| Molecular Formula | C25H36N2O8 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl (2S)-2-[[(2S)-1-[(2S,3aR,7aS)-2-carboxyoxy-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate |
| SMILES | C[C@H](N[C@@H](CCc1ccccc1)C(=O)OC(CO)CO)C(=O)N1[C@@H](OC(=O)O)C[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C25H36N2O8/c1-16(23(30)27-21-10-6-5-9-18(21)13-22(27)35-25(32)33)26-20(24(31)34-19(14-28)15-29)12-11-17-7-3-2-4-8-17/h2-4,7-8,16,18-22,26,28-29H,5-6,9-15H2,1H3,(H,32,33)/t16-,18+,20-,21-,22-/m0/s1 |
| InChIKey | KPTBXHNJKIWKRQ-VJMBVAOUSA-N |
| XLogP | 1.67 |
| TPSA | 145.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |