C27H37N3O8 — CID 59880373
(4-methyl-4-nitroso-2,3-dioxopentyl) (2S)-2-[[(2S)-1-[2-(dihydroxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate (PubChem CID 59880373) has the molecular formula C27H37N3O8 and a molecular weight of 531.61 g/mol. Its IUPAC name is (4-methyl-4-nitroso-2,3-dioxopentyl) (2S)-2-[[(2S)-1-[2-(dihydroxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate.
| Compound Name | (4-methyl-4-nitroso-2,3-dioxopentyl) (2S)-2-[[(2S)-1-[2-(dihydroxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 59880373 |
| Molecular Formula | C27H37N3O8 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | (4-methyl-4-nitroso-2,3-dioxopentyl) (2S)-2-[[(2S)-1-[2-(dihydroxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate |
| SMILES | C[C@H](N[C@@H](CCc1ccccc1)C(=O)OCC(=O)C(=O)C(C)(C)N=O)C(=O)N1C(C(O)O)CC2CCCC21 |
| InChI | InChI=1S/C27H37N3O8/c1-16(24(33)30-20-11-7-10-18(20)14-21(30)25(34)35)28-19(13-12-17-8-5-4-6-9-17)26(36)38-15-22(31)23(32)27(2,3)29-37/h4-6,8-9,16,18-21,25,28,34-35H,7,10-15H2,1-3H3/t16-,18?,19-,20?,21?/m0/s1 |
| InChIKey | SVLZKSPAMNKWBP-JFTNXMGPSA-N |
| XLogP | 1.27 |
| TPSA | 162.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|