C29H39N3O9 — CID 59880377
(4-methyl-4-nitroso-2,3,5-trioxoheptyl) (2S)-2-[[(2S)-1-[2-(dihydroxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate (PubChem CID 59880377) has the molecular formula C29H39N3O9 and a molecular weight of 573.64 g/mol. Its IUPAC name is (4-methyl-4-nitroso-2,3,5-trioxoheptyl) (2S)-2-[[(2S)-1-[2-(dihydroxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate.
| Compound Name | (4-methyl-4-nitroso-2,3,5-trioxoheptyl) (2S)-2-[[(2S)-1-[2-(dihydroxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 59880377 |
| Molecular Formula | C29H39N3O9 |
| Molecular Weight | 573.64 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | (4-methyl-4-nitroso-2,3,5-trioxoheptyl) (2S)-2-[[(2S)-1-[2-(dihydroxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoate |
| SMILES | CCC(=O)C(C)(N=O)C(=O)C(=O)COC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N1C(C(O)O)CC2CCCC21 |
| InChI | InChI=1S/C29H39N3O9/c1-4-24(34)29(3,31-40)25(35)23(33)16-41-28(39)20(14-13-18-9-6-5-7-10-18)30-17(2)26(36)32-21-12-8-11-19(21)15-22(32)27(37)38/h5-7,9-10,17,19-22,27,30,37-38H,4,8,11-16H2,1-3H3/t17-,19?,20-,21?,22?,29?/m0/s1 |
| InChIKey | VJMWLDHSHGCCGH-ZCXUDJNBSA-N |
| XLogP | 1.23 |
| TPSA | 179.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.64 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|