C13H11N3O4S2 — CID 155539552
4-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]thiophene-2-sulfonamide (PubChem CID 155539552) has the molecular formula C13H11N3O4S2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 4-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]thiophene-2-sulfonamide.
| Compound Name | 4-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 155539552 |
| Molecular Formula | C13H11N3O4S2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 4-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]thiophene-2-sulfonamide |
| SMILES | COc1cccc(-c2noc(-c3csc(S(N)(=O)=O)c3)n2)c1 |
| InChI | InChI=1S/C13H11N3O4S2/c1-19-10-4-2-3-8(5-10)12-15-13(20-16-12)9-6-11(21-7-9)22(14,17)18/h2-7H,1H3,(H2,14,17,18) |
| InChIKey | ICEIXYUDRPNZGB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |