C11H8N4O3S2 — CID 155543295
4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)thiophene-2-sulfonamide (PubChem CID 155543295) has the molecular formula C11H8N4O3S2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)thiophene-2-sulfonamide.
| Compound Name | 4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 155543295 |
| Molecular Formula | C11H8N4O3S2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(-c2nc(-c3ccccn3)no2)cs1 |
| InChI | InChI=1S/C11H8N4O3S2/c12-20(16,17)9-5-7(6-19-9)11-14-10(15-18-11)8-3-1-2-4-13-8/h1-6H,(H2,12,16,17) |
| InChIKey | IOMCGKRBBIZMQE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |