C22H18O4S — CID 155540486
2-(3,4,5-trimethoxyphenyl)benzo[h]chromene-4-thione (PubChem CID 155540486) has the molecular formula C22H18O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-(3,4,5-trimethoxyphenyl)benzo[h]chromene-4-thione.
| Compound Name | 2-(3,4,5-trimethoxyphenyl)benzo[h]chromene-4-thione |
|---|---|
| PubChem CID | 155540486 |
| Molecular Formula | C22H18O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 2-(3,4,5-trimethoxyphenyl)benzo[h]chromene-4-thione |
| SMILES | COc1cc(-c2cc(=S)c3ccc4ccccc4c3o2)cc(OC)c1OC |
| InChI | InChI=1S/C22H18O4S/c1-23-18-10-14(11-19(24-2)22(18)25-3)17-12-20(27)16-9-8-13-6-4-5-7-15(13)21(16)26-17/h4-12H,1-3H3 |
| InChIKey | DQZOUBHPTCIKDK-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 40.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|