C32H40N2O4 — CID 155542462
N-[4-[4-[3-(dimethylamino)propoxy]phenyl]cyclohexyl]-4-methoxy-3-(3-methoxyphenyl)benzamide (PubChem CID 155542462) has the molecular formula C32H40N2O4 and a molecular weight of 516.68 g/mol. Its IUPAC name is N-[4-[4-[3-(dimethylamino)propoxy]phenyl]cyclohexyl]-4-methoxy-3-(3-methoxyphenyl)benzamide.
| Compound Name | N-[4-[4-[3-(dimethylamino)propoxy]phenyl]cyclohexyl]-4-methoxy-3-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 155542462 |
| Molecular Formula | C32H40N2O4 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | N-[4-[4-[3-(dimethylamino)propoxy]phenyl]cyclohexyl]-4-methoxy-3-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(-c2cc(C(=O)NC3CCC(c4ccc(OCCCN(C)C)cc4)CC3)ccc2OC)c1 |
| InChI | InChI=1S/C32H40N2O4/c1-34(2)19-6-20-38-28-16-11-24(12-17-28)23-9-14-27(15-10-23)33-32(35)26-13-18-31(37-4)30(22-26)25-7-5-8-29(21-25)36-3/h5,7-8,11-13,16-18,21-23,27H,6,9-10,14-15,19-20H2,1-4H3,(H,33,35) |
| InChIKey | XFFJMLBGIRMJGD-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|