C28H33N3O8 — CID 155543592
7-hydroxy-4-[[4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]triazol-1-yl]methyl]chromen-2-one (PubChem CID 155543592) has the molecular formula C28H33N3O8 and a molecular weight of 539.59 g/mol. Its IUPAC name is 7-hydroxy-4-[[4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]triazol-1-yl]methyl]chromen-2-one.
| Compound Name | 7-hydroxy-4-[[4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]triazol-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 155543592 |
| Molecular Formula | C28H33N3O8 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | 7-hydroxy-4-[[4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]triazol-1-yl]methyl]chromen-2-one |
| SMILES | C[C@H]1[C@@H](OCc2cn(Cc3cc(=O)oc4cc(O)ccc34)nn2)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C28H33N3O8/c1-15-4-7-22-16(2)25(36-26-28(22)21(15)8-9-27(3,37-26)38-39-28)34-14-18-13-31(30-29-18)12-17-10-24(33)35-23-11-19(32)5-6-20(17)23/h5-6,10-11,13,15-16,21-22,25-26,32H,4,7-9,12,14H2,1-3H3/t15-,16-,21+,22+,25+,26-,27-,28-/m1/s1 |
| InChIKey | ANFPBINDQXTIFO-VOEABPQTSA-N |
| XLogP | 3.86 |
| TPSA | 127.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|