C17H21BrN4O — CID 155544430
4-bromo-2-methyl-5-[4-[(2-methylphenyl)methyl]piperazin-1-yl]pyridazin-3-one (PubChem CID 155544430) has the molecular formula C17H21BrN4O and a molecular weight of 377.29 g/mol. Its IUPAC name is 4-bromo-2-methyl-5-[4-[(2-methylphenyl)methyl]piperazin-1-yl]pyridazin-3-one.
| Compound Name | 4-bromo-2-methyl-5-[4-[(2-methylphenyl)methyl]piperazin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 155544430 |
| Molecular Formula | C17H21BrN4O |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 4-bromo-2-methyl-5-[4-[(2-methylphenyl)methyl]piperazin-1-yl]pyridazin-3-one |
| SMILES | Cc1ccccc1CN1CCN(c2cnn(C)c(=O)c2Br)CC1 |
| InChI | InChI=1S/C17H21BrN4O/c1-13-5-3-4-6-14(13)12-21-7-9-22(10-8-21)15-11-19-20(2)17(23)16(15)18/h3-6,11H,7-10,12H2,1-2H3 |
| InChIKey | JPLXJQLVLADMAX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |