C33H34F3N7O6 — CID 155545595
N-[5-[(3-amino-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]-4-[[4-[(E)-2-(3-methoxyphenyl)ethenyl]benzoyl]amino]-1-methylpyrrole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155545595) has the molecular formula C33H34F3N7O6 and a molecular weight of 681.67 g/mol. Its IUPAC name is N-[5-[(3-amino-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]-4-[[4-[(E)-2-(3-methoxyphenyl)ethenyl]benzoyl]amino]-1-methylpyrrole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[5-[(3-amino-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]-4-[[4-[(E)-2-(3-methoxyphenyl)ethenyl]benzoyl]amino]-1-methylpyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155545595 |
| Molecular Formula | C33H34F3N7O6 |
| Molecular Weight | 681.67 g/mol |
| Exact Mass | 681.25 |
| IUPAC Name | N-[5-[(3-amino-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]-4-[[4-[(E)-2-(3-methoxyphenyl)ethenyl]benzoyl]amino]-1-methylpyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)CCNC(=O)c1cc(NC(=O)c2cc(NC(=O)c3ccc(/C=C/c4cccc(OC)c4)cc3)cn2C)cn1C |
| InChI | InChI=1S/C31H33N7O4.C2HF3O2/c1-37-19-24(16-26(37)30(40)34-14-13-28(32)33)36-31(41)27-17-23(18-38(27)2)35-29(39)22-11-9-20(10-12-22)7-8-21-5-4-6-25(15-21)42-3;3-2(4,5)1(6)7/h4-12,15-19H,13-14H2,1-3H3,(H3,32,33)(H,34,40)(H,35,39)(H,36,41);(H,6,7)/b8-7+; |
| InChIKey | POWYPAKHMNCRSH-USRGLUTNSA-N |
| XLogP | 4.74 |
| TPSA | 193.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.67 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|